C14H11ClN4O4S — CID 142435577
ethyl 7-chloro-5-(hydroxyamino)-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylate (PubChem CID 142435577) has the molecular formula C14H11ClN4O4S and a molecular weight of 366.79 g/mol. Its IUPAC name is ethyl 7-chloro-5-(hydroxyamino)-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylate.
| Compound Name | ethyl 7-chloro-5-(hydroxyamino)-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 142435577 |
| Molecular Formula | C14H11ClN4O4S |
| Molecular Weight | 366.79 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | ethyl 7-chloro-5-(hydroxyamino)-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2nccs2)c2nc(Cl)cc(NO)c2c1=O |
| InChI | InChI=1S/C14H11ClN4O4S/c1-2-23-13(21)7-6-19(14-16-3-4-24-14)12-10(11(7)20)8(18-22)5-9(15)17-12/h3-6,22H,2H2,1H3,(H,17,18) |
| InChIKey | JPTVMGNIQCUIGS-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.79 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|