C14H9Cl2N3O3S — CID 175473824
5,7-dichloro-2-ethyl-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid (PubChem CID 175473824) has the molecular formula C14H9Cl2N3O3S and a molecular weight of 370.22 g/mol. Its IUPAC name is 5,7-dichloro-2-ethyl-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid.
| Compound Name | 5,7-dichloro-2-ethyl-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 175473824 |
| Molecular Formula | C14H9Cl2N3O3S |
| Molecular Weight | 370.22 g/mol |
| Exact Mass | 368.97 |
| IUPAC Name | 5,7-dichloro-2-ethyl-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid |
| SMILES | CCc1c(C(=O)O)c(=O)c2c(Cl)cc(Cl)nc2n1-c1nccs1 |
| InChI | InChI=1S/C14H9Cl2N3O3S/c1-2-7-10(13(21)22)11(20)9-6(15)5-8(16)18-12(9)19(7)14-17-3-4-23-14/h3-5H,2H2,1H3,(H,21,22) |
| InChIKey | VHJDSKAOSOBCHZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.22 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|