C15H12ClN3O3S — CID 142435553
7-chloro-1-(4-ethyl-1,3-thiazol-2-yl)-5-methyl-4-oxo-1,8-naphthyridine-3-carboxylic acid (PubChem CID 142435553) has the molecular formula C15H12ClN3O3S and a molecular weight of 349.80 g/mol. Its IUPAC name is 7-chloro-1-(4-ethyl-1,3-thiazol-2-yl)-5-methyl-4-oxo-1,8-naphthyridine-3-carboxylic acid.
| Compound Name | 7-chloro-1-(4-ethyl-1,3-thiazol-2-yl)-5-methyl-4-oxo-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 142435553 |
| Molecular Formula | C15H12ClN3O3S |
| Molecular Weight | 349.80 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 7-chloro-1-(4-ethyl-1,3-thiazol-2-yl)-5-methyl-4-oxo-1,8-naphthyridine-3-carboxylic acid |
| SMILES | CCc1csc(-n2cc(C(=O)O)c(=O)c3c(C)cc(Cl)nc32)n1 |
| InChI | InChI=1S/C15H12ClN3O3S/c1-3-8-6-23-15(17-8)19-5-9(14(21)22)12(20)11-7(2)4-10(16)18-13(11)19/h4-6H,3H2,1-2H3,(H,21,22) |
| InChIKey | YBFBRNAYBRHPCR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.80 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|