C17H10ClN5O3S — CID 142435714
7-chloro-5-methyl-4-oxo-1-(3-pyridin-4-yl-1,2,4-thiadiazol-5-yl)-1,8-naphthyridine-3-carboxylic acid (PubChem CID 142435714) has the molecular formula C17H10ClN5O3S and a molecular weight of 399.82 g/mol. Its IUPAC name is 7-chloro-5-methyl-4-oxo-1-(3-pyridin-4-yl-1,2,4-thiadiazol-5-yl)-1,8-naphthyridine-3-carboxylic acid.
| Compound Name | 7-chloro-5-methyl-4-oxo-1-(3-pyridin-4-yl-1,2,4-thiadiazol-5-yl)-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 142435714 |
| Molecular Formula | C17H10ClN5O3S |
| Molecular Weight | 399.82 g/mol |
| Exact Mass | 399.02 |
| IUPAC Name | 7-chloro-5-methyl-4-oxo-1-(3-pyridin-4-yl-1,2,4-thiadiazol-5-yl)-1,8-naphthyridine-3-carboxylic acid |
| SMILES | Cc1cc(Cl)nc2c1c(=O)c(C(=O)O)cn2-c1nc(-c2ccncc2)ns1 |
| InChI | InChI=1S/C17H10ClN5O3S/c1-8-6-11(18)20-15-12(8)13(24)10(16(25)26)7-23(15)17-21-14(22-27-17)9-2-4-19-5-3-9/h2-7H,1H3,(H,25,26) |
| InChIKey | XJSSNAOJBRYWOU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.82 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|