C19H13ClN4O3S — CID 18969092
5-(benzylamino)-7-chloro-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid (PubChem CID 18969092) has the molecular formula C19H13ClN4O3S and a molecular weight of 412.86 g/mol. Its IUPAC name is 5-(benzylamino)-7-chloro-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid.
| Compound Name | 5-(benzylamino)-7-chloro-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 18969092 |
| Molecular Formula | C19H13ClN4O3S |
| Molecular Weight | 412.86 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | 5-(benzylamino)-7-chloro-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cn(-c2nccs2)c2nc(Cl)cc(NCc3ccccc3)c2c1=O |
| InChI | InChI=1S/C19H13ClN4O3S/c20-14-8-13(22-9-11-4-2-1-3-5-11)15-16(25)12(18(26)27)10-24(17(15)23-14)19-21-6-7-28-19/h1-8,10H,9H2,(H,22,23)(H,26,27) |
| InChIKey | XMZVDDBBYQGNRH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.86 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|