C16H10ClF2N3O3 — CID 134181833
ethyl 7-chloro-1-(3,5-difluoro-2-pyridinyl)-4-oxo-1,8-naphthyridine-3-carboxylate (PubChem CID 134181833) has the molecular formula C16H10ClF2N3O3 and a molecular weight of 365.72 g/mol. Its IUPAC name is ethyl 7-chloro-1-(3,5-difluoro-2-pyridinyl)-4-oxo-1,8-naphthyridine-3-carboxylate.
| Compound Name | ethyl 7-chloro-1-(3,5-difluoro-2-pyridinyl)-4-oxo-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 134181833 |
| Molecular Formula | C16H10ClF2N3O3 |
| Molecular Weight | 365.72 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | ethyl 7-chloro-1-(3,5-difluoro-2-pyridinyl)-4-oxo-1,8-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2ncc(F)cc2F)c2nc(Cl)ccc2c1=O |
| InChI | InChI=1S/C16H10ClF2N3O3/c1-2-25-16(24)10-7-22(15-11(19)5-8(18)6-20-15)14-9(13(10)23)3-4-12(17)21-14/h3-7H,2H2,1H3 |
| InChIKey | SZGDJXTVENMWKB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.72 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|