C11H7Cl2FN2O2 — CID 23129198
2,6-dichloro-5-fluoropyridine-3-carboxylic acid;pyridine (PubChem CID 23129198) has the molecular formula C11H7Cl2FN2O2 and a molecular weight of 289.09 g/mol. Its IUPAC name is 2,6-dichloro-5-fluoropyridine-3-carboxylic acid;pyridine.
| Compound Name | 2,6-dichloro-5-fluoropyridine-3-carboxylic acid;pyridine |
|---|---|
| PubChem CID | 23129198 |
| Molecular Formula | C11H7Cl2FN2O2 |
| Molecular Weight | 289.09 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | 2,6-dichloro-5-fluoropyridine-3-carboxylic acid;pyridine |
| SMILES | O=C(O)c1cc(F)c(Cl)nc1Cl.c1ccncc1 |
| InChI | InChI=1S/C6H2Cl2FNO2.C5H5N/c7-4-2(6(11)12)1-3(9)5(8)10-4;1-2-4-6-5-3-1/h1H,(H,11,12);1-5H |
| InChIKey | HMBFPAPRTAEMLW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.09 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|