C19H12Cl2F2N2O3 — CID 174633098
(2,6-dichloro-5-fluoro-3-pyridinyl)-(2-fluorophenyl)methanone;2-hydroxybenzamide (PubChem CID 174633098) has the molecular formula C19H12Cl2F2N2O3 and a molecular weight of 425.22 g/mol. Its IUPAC name is (2,6-dichloro-5-fluoro-3-pyridinyl)-(2-fluorophenyl)methanone;2-hydroxybenzamide.
| Compound Name | (2,6-dichloro-5-fluoro-3-pyridinyl)-(2-fluorophenyl)methanone;2-hydroxybenzamide |
|---|---|
| PubChem CID | 174633098 |
| Molecular Formula | C19H12Cl2F2N2O3 |
| Molecular Weight | 425.22 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | (2,6-dichloro-5-fluoro-3-pyridinyl)-(2-fluorophenyl)methanone;2-hydroxybenzamide |
| SMILES | NC(=O)c1ccccc1O.O=C(c1ccccc1F)c1cc(F)c(Cl)nc1Cl |
| InChI | InChI=1S/C12H5Cl2F2NO.C7H7NO2/c13-11-7(5-9(16)12(14)17-11)10(18)6-3-1-2-4-8(6)15;8-7(10)5-3-1-2-4-6(5)9/h1-5H;1-4,9H,(H2,8,10) |
| InChIKey | XCCNPVBNJINSFA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.22 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|