C13H10F3NO4 — CID 22840174
6,7,8-trifluoro-1-[(2S)-1-hydroxypropan-2-yl]-4-oxoquinoline-3-carboxylic acid (PubChem CID 22840174) has the molecular formula C13H10F3NO4 and a molecular weight of 301.22 g/mol. Its IUPAC name is 6,7,8-trifluoro-1-[(2S)-1-hydroxypropan-2-yl]-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 6,7,8-trifluoro-1-[(2S)-1-hydroxypropan-2-yl]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 22840174 |
| Molecular Formula | C13H10F3NO4 |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 6,7,8-trifluoro-1-[(2S)-1-hydroxypropan-2-yl]-4-oxoquinoline-3-carboxylic acid |
| SMILES | C[C@@H](CO)n1cc(C(=O)O)c(=O)c2cc(F)c(F)c(F)c21 |
| InChI | InChI=1S/C13H10F3NO4/c1-5(4-18)17-3-7(13(20)21)12(19)6-2-8(14)9(15)10(16)11(6)17/h2-3,5,18H,4H2,1H3,(H,20,21)/t5-/m0/s1 |
| InChIKey | FRMAUTHKMLGXRM-YFKPBYRVSA-N |
| XLogP | 1.67 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|