C32H32N8O5S — CID 11354191
ethyl 7-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]-6-nitro-4-oxo-1-(4-piperazin-1-yl-2-pyridinyl)quinoline-3-carboxylate (PubChem CID 11354191) has the molecular formula C32H32N8O5S and a molecular weight of 640.73 g/mol. Its IUPAC name is ethyl 7-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]-6-nitro-4-oxo-1-(4-piperazin-1-yl-2-pyridinyl)quinoline-3-carboxylate.
| Compound Name | ethyl 7-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]-6-nitro-4-oxo-1-(4-piperazin-1-yl-2-pyridinyl)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 11354191 |
| Molecular Formula | C32H32N8O5S |
| Molecular Weight | 640.73 g/mol |
| Exact Mass | 640.22 |
| IUPAC Name | ethyl 7-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]-6-nitro-4-oxo-1-(4-piperazin-1-yl-2-pyridinyl)quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2cc(N3CCNCC3)ccn2)c2cc(N3CCN(c4nc5ccccc5s4)CC3)c([N+](=O)[O-])cc2c1=O |
| InChI | InChI=1S/C32H32N8O5S/c1-2-45-31(42)23-20-39(29-17-21(7-8-34-29)36-11-9-33-10-12-36)25-19-26(27(40(43)44)18-22(25)30(23)41)37-13-15-38(16-14-37)32-35-24-5-3-4-6-28(24)46-32/h3-8,17-20,33H,2,9-16H2,1H3 |
| InChIKey | HPUKQNSLOGKPSX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 138.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.73 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|