C23H22FNO3Si — CID 10024380
ethyl 1-(4-fluorophenyl)-4-oxo-7-(2-trimethylsilylethynyl)quinoline-3-carboxylate (PubChem CID 10024380) has the molecular formula C23H22FNO3Si and a molecular weight of 407.52 g/mol. Its IUPAC name is ethyl 1-(4-fluorophenyl)-4-oxo-7-(2-trimethylsilylethynyl)quinoline-3-carboxylate.
| Compound Name | ethyl 1-(4-fluorophenyl)-4-oxo-7-(2-trimethylsilylethynyl)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 10024380 |
| Molecular Formula | C23H22FNO3Si |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | ethyl 1-(4-fluorophenyl)-4-oxo-7-(2-trimethylsilylethynyl)quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2ccc(F)cc2)c2cc(C#C[Si](C)(C)C)ccc2c1=O |
| InChI | InChI=1S/C23H22FNO3Si/c1-5-28-23(27)20-15-25(18-9-7-17(24)8-10-18)21-14-16(12-13-29(2,3)4)6-11-19(21)22(20)26/h6-11,14-15H,5H2,1-4H3 |
| InChIKey | XHMLBXYIEQZMOU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|