C16H17IN2O4 — CID 135309002
diethyl 1-benzyl-4-iodopyrazole-3,5-dicarboxylate (PubChem CID 135309002) has the molecular formula C16H17IN2O4 and a molecular weight of 428.23 g/mol. Its IUPAC name is diethyl 1-benzyl-4-iodopyrazole-3,5-dicarboxylate.
| Compound Name | diethyl 1-benzyl-4-iodopyrazole-3,5-dicarboxylate |
|---|---|
| PubChem CID | 135309002 |
| Molecular Formula | C16H17IN2O4 |
| Molecular Weight | 428.23 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | diethyl 1-benzyl-4-iodopyrazole-3,5-dicarboxylate |
| SMILES | CCOC(=O)c1nn(Cc2ccccc2)c(C(=O)OCC)c1I |
| InChI | InChI=1S/C16H17IN2O4/c1-3-22-15(20)13-12(17)14(16(21)23-4-2)19(18-13)10-11-8-6-5-7-9-11/h5-9H,3-4,10H2,1-2H3 |
| InChIKey | WFOXVCMWJWLHNX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.23 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|