methyl 1-phenyl-4-phenylmethoxynaphthalene-2-carboxylate

C25H20O3 — CID 147669047

IUPACmethyl 1-phenyl-4-phenylmethoxynaphthalene-2-carboxylate
SMILESCOC(=O)c1cc(OCc2ccccc2)c2ccccc2c1-c1ccccc1
InChIInChI=1S/C25H20O3/c1-27-25(26)22-16-23(28-17-18-10-4-2-5-11-18)20-14-8-9-15-21(20)24(22)19-12-6-3-7-13-19/h2-16H,17H2,1H3
InChIKeyGMWCPKFSAULJJJ-UHFFFAOYSA-N
MW368.43 g/mol
LogP5.87
Rot. Bonds5

About methyl 1-phenyl-4-phenylmethoxynaphthalene-2-carboxylate

methyl 1-phenyl-4-phenylmethoxynaphthalene-2-carboxylate (PubChem CID 147669047) has the molecular formula C25H20O3 and a molecular weight of 368.43 g/mol. Its IUPAC name is methyl 1-phenyl-4-phenylmethoxynaphthalene-2-carboxylate.

Molecular Properties

Compound Namemethyl 1-phenyl-4-phenylmethoxynaphthalene-2-carboxylate
PubChem CID147669047
Molecular FormulaC25H20O3
Molecular Weight368.43 g/mol
Exact Mass368.14
IUPAC Namemethyl 1-phenyl-4-phenylmethoxynaphthalene-2-carboxylate
SMILESCOC(=O)c1cc(OCc2ccccc2)c2ccccc2c1-c1ccccc1
InChIInChI=1S/C25H20O3/c1-27-25(26)22-16-23(28-17-18-10-4-2-5-11-18)20-14-8-9-15-21(20)24(22)19-12-6-3-7-13-19/h2-16H,17H2,1H3
InChIKeyGMWCPKFSAULJJJ-UHFFFAOYSA-N
XLogP5.87
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms28
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500368.43
LogP ≤ 55.87
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 1-phenyl-4-phenylmethoxynaphthalene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1-phenyl-4-phenylmethoxynaphthalene-2-carboxylate?
The IUPAC name of methyl 1-phenyl-4-phenylmethoxynaphthalene-2-carboxylate (CID 147669047) is methyl 1-phenyl-4-phenylmethoxynaphthalene-2-carboxylate.
What is the SMILES notation for methyl 1-phenyl-4-phenylmethoxynaphthalene-2-carboxylate?
The canonical SMILES for methyl 1-phenyl-4-phenylmethoxynaphthalene-2-carboxylate is COC(=O)c1cc(OCc2ccccc2)c2ccccc2c1-c1ccccc1.
What is the InChIKey of methyl 1-phenyl-4-phenylmethoxynaphthalene-2-carboxylate?
The InChIKey is GMWCPKFSAULJJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20O3/c1-27-25(26)22-16-23(28-17-18-10-4-2-5-11-18)20-14-8-9-15-21(20)24(22)19-12-6-3-7-13-19/h2-16H,17H2,1H3.
What are the key properties of methyl 1-phenyl-4-phenylmethoxynaphthalene-2-carboxylate?
methyl 1-phenyl-4-phenylmethoxynaphthalene-2-carboxylate has a molecular weight of 368.43 g/mol, XLogP of 5.87, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-phenyl-4-phenylmethoxynaphthalene-2-carboxylate is sourced from PubChem (CID 147669047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).