C21H29NO10 — CID 168567846
dimethyl (E)-2-[2-ethoxycarbonyl-4,5-bis(2-methoxyethoxy)anilino]but-2-enedioate (PubChem CID 168567846) has the molecular formula C21H29NO10 and a molecular weight of 455.46 g/mol. Its IUPAC name is dimethyl (E)-2-[2-ethoxycarbonyl-4,5-bis(2-methoxyethoxy)anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[2-ethoxycarbonyl-4,5-bis(2-methoxyethoxy)anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168567846 |
| Molecular Formula | C21H29NO10 |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | dimethyl (E)-2-[2-ethoxycarbonyl-4,5-bis(2-methoxyethoxy)anilino]but-2-enedioate |
| SMILES | CCOC(=O)c1cc(OCCOC)c(OCCOC)cc1N/C(=C/C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C21H29NO10/c1-6-30-20(24)14-11-17(31-9-7-26-2)18(32-10-8-27-3)12-15(14)22-16(21(25)29-5)13-19(23)28-4/h11-13,22H,6-10H2,1-5H3/b16-13+ |
| InChIKey | GRDPLGIXHHLKRR-DTQAZKPQSA-N |
| XLogP | 1.56 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|