C13H21ClN2O3 — CID 118213596
4-chloro-1-N-ethyl-5-[2-(2-methoxyethoxy)ethoxy]benzene-1,2-diamine (PubChem CID 118213596) has the molecular formula C13H21ClN2O3 and a molecular weight of 288.78 g/mol. Its IUPAC name is 4-chloro-1-N-ethyl-5-[2-(2-methoxyethoxy)ethoxy]benzene-1,2-diamine.
| Compound Name | 4-chloro-1-N-ethyl-5-[2-(2-methoxyethoxy)ethoxy]benzene-1,2-diamine |
|---|---|
| PubChem CID | 118213596 |
| Molecular Formula | C13H21ClN2O3 |
| Molecular Weight | 288.78 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 4-chloro-1-N-ethyl-5-[2-(2-methoxyethoxy)ethoxy]benzene-1,2-diamine |
| SMILES | CCNc1cc(OCCOCCOC)c(Cl)cc1N |
| InChI | InChI=1S/C13H21ClN2O3/c1-3-16-12-9-13(10(14)8-11(12)15)19-7-6-18-5-4-17-2/h8-9,16H,3-7,15H2,1-2H3 |
| InChIKey | OHWXURKJXQMMQD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.78 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|