C12H20N2O3 — CID 143666027
3-[2-(2-methoxyethoxy)ethoxy]-2-N-methylbenzene-1,2-diamine (PubChem CID 143666027) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is 3-[2-(2-methoxyethoxy)ethoxy]-2-N-methylbenzene-1,2-diamine.
| Compound Name | 3-[2-(2-methoxyethoxy)ethoxy]-2-N-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 143666027 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 3-[2-(2-methoxyethoxy)ethoxy]-2-N-methylbenzene-1,2-diamine |
| SMILES | CNc1c(N)cccc1OCCOCCOC |
| InChI | InChI=1S/C12H20N2O3/c1-14-12-10(13)4-3-5-11(12)17-9-8-16-7-6-15-2/h3-5,14H,6-9,13H2,1-2H3 |
| InChIKey | MJLMCZSVRAGXIC-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|