[2,4-dichloro-5-(2-methoxyethoxy)phenyl]boronic acid

C9H11BCl2O4 — CID 53216451

IUPAC[2,4-dichloro-5-(2-methoxyethoxy)phenyl]boronic acid
SMILESCOCCOc1cc(B(O)O)c(Cl)cc1Cl
InChIInChI=1S/C9H11BCl2O4/c1-15-2-3-16-9-4-6(10(13)14)7(11)5-8(9)12/h4-5,13-14H,2-3H2,1H3
InChIKeyRNOGFSLJRIPEMF-UHFFFAOYSA-N
MW264.90 g/mol
LogP0.70
Rot. Bonds5

About [2,4-dichloro-5-(2-methoxyethoxy)phenyl]boronic acid

[2,4-dichloro-5-(2-methoxyethoxy)phenyl]boronic acid (PubChem CID 53216451) has the molecular formula C9H11BCl2O4 and a molecular weight of 264.90 g/mol. Its IUPAC name is [2,4-dichloro-5-(2-methoxyethoxy)phenyl]boronic acid.

Molecular Properties

Compound Name[2,4-dichloro-5-(2-methoxyethoxy)phenyl]boronic acid
PubChem CID53216451
Molecular FormulaC9H11BCl2O4
Molecular Weight264.90 g/mol
Exact Mass264.01
IUPAC Name[2,4-dichloro-5-(2-methoxyethoxy)phenyl]boronic acid
SMILESCOCCOc1cc(B(O)O)c(Cl)cc1Cl
InChIInChI=1S/C9H11BCl2O4/c1-15-2-3-16-9-4-6(10(13)14)7(11)5-8(9)12/h4-5,13-14H,2-3H2,1H3
InChIKeyRNOGFSLJRIPEMF-UHFFFAOYSA-N
XLogP0.70
TPSA58.92 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.90
LogP ≤ 50.70
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [2,4-dichloro-5-(2-methoxyethoxy)phenyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2,4-dichloro-5-(2-methoxyethoxy)phenyl]boronic acid?
The IUPAC name of [2,4-dichloro-5-(2-methoxyethoxy)phenyl]boronic acid (CID 53216451) is [2,4-dichloro-5-(2-methoxyethoxy)phenyl]boronic acid.
What is the SMILES notation for [2,4-dichloro-5-(2-methoxyethoxy)phenyl]boronic acid?
The canonical SMILES for [2,4-dichloro-5-(2-methoxyethoxy)phenyl]boronic acid is COCCOc1cc(B(O)O)c(Cl)cc1Cl.
What is the InChIKey of [2,4-dichloro-5-(2-methoxyethoxy)phenyl]boronic acid?
The InChIKey is RNOGFSLJRIPEMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BCl2O4/c1-15-2-3-16-9-4-6(10(13)14)7(11)5-8(9)12/h4-5,13-14H,2-3H2,1H3.
What are the key properties of [2,4-dichloro-5-(2-methoxyethoxy)phenyl]boronic acid?
[2,4-dichloro-5-(2-methoxyethoxy)phenyl]boronic acid has a molecular weight of 264.90 g/mol, XLogP of 0.70, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2,4-dichloro-5-(2-methoxyethoxy)phenyl]boronic acid is sourced from PubChem (CID 53216451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).