C9H11BCl2O4 — CID 53216451
[2,4-dichloro-5-(2-methoxyethoxy)phenyl]boronic acid (PubChem CID 53216451) has the molecular formula C9H11BCl2O4 and a molecular weight of 264.90 g/mol. Its IUPAC name is [2,4-dichloro-5-(2-methoxyethoxy)phenyl]boronic acid.
| Compound Name | [2,4-dichloro-5-(2-methoxyethoxy)phenyl]boronic acid |
|---|---|
| PubChem CID | 53216451 |
| Molecular Formula | C9H11BCl2O4 |
| Molecular Weight | 264.90 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | [2,4-dichloro-5-(2-methoxyethoxy)phenyl]boronic acid |
| SMILES | COCCOc1cc(B(O)O)c(Cl)cc1Cl |
| InChI | InChI=1S/C9H11BCl2O4/c1-15-2-3-16-9-4-6(10(13)14)7(11)5-8(9)12/h4-5,13-14H,2-3H2,1H3 |
| InChIKey | RNOGFSLJRIPEMF-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.90 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|