C13H10BCl3O3 — CID 63457088
[2-[(2,4,5-trichlorophenoxy)methyl]phenyl]boronic acid (PubChem CID 63457088) has the molecular formula C13H10BCl3O3 and a molecular weight of 331.39 g/mol. Its IUPAC name is [2-[(2,4,5-trichlorophenoxy)methyl]phenyl]boronic acid.
| Compound Name | [2-[(2,4,5-trichlorophenoxy)methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 63457088 |
| Molecular Formula | C13H10BCl3O3 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 329.98 |
| IUPAC Name | [2-[(2,4,5-trichlorophenoxy)methyl]phenyl]boronic acid |
| SMILES | OB(O)c1ccccc1COc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H10BCl3O3/c15-10-5-12(17)13(6-11(10)16)20-7-8-3-1-2-4-9(8)14(18)19/h1-6,18-19H,7H2 |
| InChIKey | RLNHOMSWSRWUSK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|