C9H9Cl2IO2 — CID 141259276
1,5-dichloro-2-iodo-3-(2-methoxyethoxy)benzene (PubChem CID 141259276) has the molecular formula C9H9Cl2IO2 and a molecular weight of 346.98 g/mol. Its IUPAC name is 1,5-dichloro-2-iodo-3-(2-methoxyethoxy)benzene.
| Compound Name | 1,5-dichloro-2-iodo-3-(2-methoxyethoxy)benzene |
|---|---|
| PubChem CID | 141259276 |
| Molecular Formula | C9H9Cl2IO2 |
| Molecular Weight | 346.98 g/mol |
| Exact Mass | 345.90 |
| IUPAC Name | 1,5-dichloro-2-iodo-3-(2-methoxyethoxy)benzene |
| SMILES | COCCOc1cc(Cl)cc(Cl)c1I |
| InChI | InChI=1S/C9H9Cl2IO2/c1-13-2-3-14-8-5-6(10)4-7(11)9(8)12/h4-5H,2-3H2,1H3 |
| InChIKey | OBZZHJHJSLPHOO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.98 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|