C8H9Cl2NO2 — CID 130154996
2-(2-aminoethoxy)-4,6-dichlorophenol (PubChem CID 130154996) has the molecular formula C8H9Cl2NO2 and a molecular weight of 222.07 g/mol. Its IUPAC name is 2-(2-aminoethoxy)-4,6-dichlorophenol.
| Compound Name | 2-(2-aminoethoxy)-4,6-dichlorophenol |
|---|---|
| PubChem CID | 130154996 |
| Molecular Formula | C8H9Cl2NO2 |
| Molecular Weight | 222.07 g/mol |
| Exact Mass | 221.00 |
| IUPAC Name | 2-(2-aminoethoxy)-4,6-dichlorophenol |
| SMILES | NCCOc1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C8H9Cl2NO2/c9-5-3-6(10)8(12)7(4-5)13-2-1-11/h3-4,12H,1-2,11H2 |
| InChIKey | HKNMHSQFPXRQSQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.07 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |