C17H19Cl2NO7 — CID 168635660
dimethyl 3-[2,4-dichloro-5-(2-methoxyethoxy)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate (PubChem CID 168635660) has the molecular formula C17H19Cl2NO7 and a molecular weight of 420.25 g/mol. Its IUPAC name is dimethyl 3-[2,4-dichloro-5-(2-methoxyethoxy)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[2,4-dichloro-5-(2-methoxyethoxy)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 168635660 |
| Molecular Formula | C17H19Cl2NO7 |
| Molecular Weight | 420.25 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | dimethyl 3-[2,4-dichloro-5-(2-methoxyethoxy)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
| SMILES | COCCOc1cc(N2COCC(C(=O)OC)=C2C(=O)OC)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H19Cl2NO7/c1-23-4-5-27-14-7-13(11(18)6-12(14)19)20-9-26-8-10(16(21)24-2)15(20)17(22)25-3/h6-7H,4-5,8-9H2,1-3H3 |
| InChIKey | WJCLAHCPOKTKQN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.25 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|