C18H19N3O6S — CID 20927097
N-(2,5-diethoxyphenyl)-5-(6-oxo-1H-pyridazin-3-yl)furan-2-sulfonamide (PubChem CID 20927097) has the molecular formula C18H19N3O6S and a molecular weight of 405.43 g/mol. Its IUPAC name is N-(2,5-diethoxyphenyl)-5-(6-oxo-1H-pyridazin-3-yl)furan-2-sulfonamide.
| Compound Name | N-(2,5-diethoxyphenyl)-5-(6-oxo-1H-pyridazin-3-yl)furan-2-sulfonamide |
|---|---|
| PubChem CID | 20927097 |
| Molecular Formula | C18H19N3O6S |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | N-(2,5-diethoxyphenyl)-5-(6-oxo-1H-pyridazin-3-yl)furan-2-sulfonamide |
| SMILES | CCOc1ccc(OCC)c(NS(=O)(=O)c2ccc(-c3ccc(=O)[nH]n3)o2)c1 |
| InChI | InChI=1S/C18H19N3O6S/c1-3-25-12-5-7-15(26-4-2)14(11-12)21-28(23,24)18-10-8-16(27-18)13-6-9-17(22)20-19-13/h5-11,21H,3-4H2,1-2H3,(H,20,22) |
| InChIKey | DWORXJPMUPHIPH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 123.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |