C16H15N3O4S — CID 20927054
N-(3,4-dimethylphenyl)-5-(6-oxo-1H-pyridazin-3-yl)furan-2-sulfonamide (PubChem CID 20927054) has the molecular formula C16H15N3O4S and a molecular weight of 345.38 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-5-(6-oxo-1H-pyridazin-3-yl)furan-2-sulfonamide.
| Compound Name | N-(3,4-dimethylphenyl)-5-(6-oxo-1H-pyridazin-3-yl)furan-2-sulfonamide |
|---|---|
| PubChem CID | 20927054 |
| Molecular Formula | C16H15N3O4S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | N-(3,4-dimethylphenyl)-5-(6-oxo-1H-pyridazin-3-yl)furan-2-sulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(-c3ccc(=O)[nH]n3)o2)cc1C |
| InChI | InChI=1S/C16H15N3O4S/c1-10-3-4-12(9-11(10)2)19-24(21,22)16-8-6-14(23-16)13-5-7-15(20)18-17-13/h3-9,19H,1-2H3,(H,18,20) |
| InChIKey | MFWVQKAKMALVAO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |