C15H12ClN3O4S2 — CID 20923062
N-(3-chloro-4-methoxyphenyl)-5-(6-oxo-1H-pyridazin-3-yl)thiophene-2-sulfonamide (PubChem CID 20923062) has the molecular formula C15H12ClN3O4S2 and a molecular weight of 397.87 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-5-(6-oxo-1H-pyridazin-3-yl)thiophene-2-sulfonamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-5-(6-oxo-1H-pyridazin-3-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 20923062 |
| Molecular Formula | C15H12ClN3O4S2 |
| Molecular Weight | 397.87 g/mol |
| Exact Mass | 397.00 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-5-(6-oxo-1H-pyridazin-3-yl)thiophene-2-sulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(-c3ccc(=O)[nH]n3)s2)cc1Cl |
| InChI | InChI=1S/C15H12ClN3O4S2/c1-23-12-4-2-9(8-10(12)16)19-25(21,22)15-7-5-13(24-15)11-3-6-14(20)18-17-11/h2-8,19H,1H3,(H,18,20) |
| InChIKey | WYMSFVPGWQNQCA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.87 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |