C15H13N3O4S2 — CID 53134871
N-(4-methoxyphenyl)-4-(6-oxo-1H-pyridazin-3-yl)thiophene-2-sulfonamide (PubChem CID 53134871) has the molecular formula C15H13N3O4S2 and a molecular weight of 363.42 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-4-(6-oxo-1H-pyridazin-3-yl)thiophene-2-sulfonamide.
| Compound Name | N-(4-methoxyphenyl)-4-(6-oxo-1H-pyridazin-3-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 53134871 |
| Molecular Formula | C15H13N3O4S2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | N-(4-methoxyphenyl)-4-(6-oxo-1H-pyridazin-3-yl)thiophene-2-sulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(-c3ccc(=O)[nH]n3)cs2)cc1 |
| InChI | InChI=1S/C15H13N3O4S2/c1-22-12-4-2-11(3-5-12)18-24(20,21)15-8-10(9-23-15)13-6-7-14(19)17-16-13/h2-9,18H,1H3,(H,17,19) |
| InChIKey | ZAASJHQEUSRSDX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |