C24H19N3O5S3 — CID 23589786
4-(benzenesulfonyl)-N-[3-(4-methoxyphenyl)-1H-indazol-5-yl]thiophene-2-sulfonamide (PubChem CID 23589786) has the molecular formula C24H19N3O5S3 and a molecular weight of 525.63 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-N-[3-(4-methoxyphenyl)-1H-indazol-5-yl]thiophene-2-sulfonamide.
| Compound Name | 4-(benzenesulfonyl)-N-[3-(4-methoxyphenyl)-1H-indazol-5-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 23589786 |
| Molecular Formula | C24H19N3O5S3 |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.05 |
| IUPAC Name | 4-(benzenesulfonyl)-N-[3-(4-methoxyphenyl)-1H-indazol-5-yl]thiophene-2-sulfonamide |
| SMILES | COc1ccc(-c2n[nH]c3ccc(NS(=O)(=O)c4cc(S(=O)(=O)c5ccccc5)cs4)cc23)cc1 |
| InChI | InChI=1S/C24H19N3O5S3/c1-32-18-10-7-16(8-11-18)24-21-13-17(9-12-22(21)25-26-24)27-35(30,31)23-14-20(15-33-23)34(28,29)19-5-3-2-4-6-19/h2-15,27H,1H3,(H,25,26) |
| InChIKey | HBVUKYGQMMWAQC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |