C15H11ClFN3O3S2 — CID 53135075
N-[(2-chloro-4-fluorophenyl)methyl]-4-(6-oxo-1H-pyridazin-3-yl)thiophene-2-sulfonamide (PubChem CID 53135075) has the molecular formula C15H11ClFN3O3S2 and a molecular weight of 399.86 g/mol. Its IUPAC name is N-[(2-chloro-4-fluorophenyl)methyl]-4-(6-oxo-1H-pyridazin-3-yl)thiophene-2-sulfonamide.
| Compound Name | N-[(2-chloro-4-fluorophenyl)methyl]-4-(6-oxo-1H-pyridazin-3-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 53135075 |
| Molecular Formula | C15H11ClFN3O3S2 |
| Molecular Weight | 399.86 g/mol |
| Exact Mass | 398.99 |
| IUPAC Name | N-[(2-chloro-4-fluorophenyl)methyl]-4-(6-oxo-1H-pyridazin-3-yl)thiophene-2-sulfonamide |
| SMILES | O=c1ccc(-c2csc(S(=O)(=O)NCc3ccc(F)cc3Cl)c2)n[nH]1 |
| InChI | InChI=1S/C15H11ClFN3O3S2/c16-12-6-11(17)2-1-9(12)7-18-25(22,23)15-5-10(8-24-15)13-3-4-14(21)20-19-13/h1-6,8,18H,7H2,(H,20,21) |
| InChIKey | YKIFCTZAWKVEJA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.86 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |