C16H15N3O3S2 — CID 53134955
N-[(3-methylphenyl)methyl]-4-(6-oxo-1H-pyridazin-3-yl)thiophene-2-sulfonamide (PubChem CID 53134955) has the molecular formula C16H15N3O3S2 and a molecular weight of 361.45 g/mol. Its IUPAC name is N-[(3-methylphenyl)methyl]-4-(6-oxo-1H-pyridazin-3-yl)thiophene-2-sulfonamide.
| Compound Name | N-[(3-methylphenyl)methyl]-4-(6-oxo-1H-pyridazin-3-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 53134955 |
| Molecular Formula | C16H15N3O3S2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | N-[(3-methylphenyl)methyl]-4-(6-oxo-1H-pyridazin-3-yl)thiophene-2-sulfonamide |
| SMILES | Cc1cccc(CNS(=O)(=O)c2cc(-c3ccc(=O)[nH]n3)cs2)c1 |
| InChI | InChI=1S/C16H15N3O3S2/c1-11-3-2-4-12(7-11)9-17-24(21,22)16-8-13(10-23-16)14-5-6-15(20)19-18-14/h2-8,10,17H,9H2,1H3,(H,19,20) |
| InChIKey | ZGGNKJPLEPVENB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |