C17H18N2O2S3 — CID 50839010
N-benzyl-4-(4-propan-2-yl-1,3-thiazol-2-yl)thiophene-2-sulfonamide (PubChem CID 50839010) has the molecular formula C17H18N2O2S3 and a molecular weight of 378.54 g/mol. Its IUPAC name is N-benzyl-4-(4-propan-2-yl-1,3-thiazol-2-yl)thiophene-2-sulfonamide.
| Compound Name | N-benzyl-4-(4-propan-2-yl-1,3-thiazol-2-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 50839010 |
| Molecular Formula | C17H18N2O2S3 |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | N-benzyl-4-(4-propan-2-yl-1,3-thiazol-2-yl)thiophene-2-sulfonamide |
| SMILES | CC(C)c1csc(-c2csc(S(=O)(=O)NCc3ccccc3)c2)n1 |
| InChI | InChI=1S/C17H18N2O2S3/c1-12(2)15-11-23-17(19-15)14-8-16(22-10-14)24(20,21)18-9-13-6-4-3-5-7-13/h3-8,10-12,18H,9H2,1-2H3 |
| InChIKey | ZGYCJCPARKJWQC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |