C17H16N2O2S2 — CID 54774062
N-[[3-(4-methyl-1,3-thiazol-2-yl)phenyl]methyl]benzenesulfonamide (PubChem CID 54774062) has the molecular formula C17H16N2O2S2 and a molecular weight of 344.46 g/mol. Its IUPAC name is N-[[3-(4-methyl-1,3-thiazol-2-yl)phenyl]methyl]benzenesulfonamide.
| Compound Name | N-[[3-(4-methyl-1,3-thiazol-2-yl)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 54774062 |
| Molecular Formula | C17H16N2O2S2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | N-[[3-(4-methyl-1,3-thiazol-2-yl)phenyl]methyl]benzenesulfonamide |
| SMILES | Cc1csc(-c2cccc(CNS(=O)(=O)c3ccccc3)c2)n1 |
| InChI | InChI=1S/C17H16N2O2S2/c1-13-12-22-17(19-13)15-7-5-6-14(10-15)11-18-23(20,21)16-8-3-2-4-9-16/h2-10,12,18H,11H2,1H3 |
| InChIKey | HJOUXYQPTIIWRQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |