About methyl 2-[3-[[(3-bromo-5-methylphenyl)sulfonylamino]methyl]phenyl]-1,3-thiazole-4-carboxylate
methyl 2-[3-[[(3-bromo-5-methylphenyl)sulfonylamino]methyl]phenyl]-1,3-thiazole-4-carboxylate (PubChem CID 166333497) has the molecular formula C19H17BrN2O4S2
and a molecular weight of 481.39 g/mol. Its IUPAC name is methyl 2-[3-[[(3-bromo-5-methylphenyl)sulfonylamino]methyl]phenyl]-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 2-[3-[[(3-bromo-5-methylphenyl)sulfonylamino]methyl]phenyl]-1,3-thiazole-4-carboxylate |
| PubChem CID | 166333497 |
| Molecular Formula | C19H17BrN2O4S2 |
| Molecular Weight | 481.39 g/mol |
| Exact Mass | 479.98 |
| IUPAC Name | methyl 2-[3-[[(3-bromo-5-methylphenyl)sulfonylamino]methyl]phenyl]-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1csc(-c2cccc(CNS(=O)(=O)c3cc(C)cc(Br)c3)c2)n1 |
| InChI | InChI=1S/C19H17BrN2O4S2/c1-12-6-15(20)9-16(7-12)28(24,25)21-10-13-4-3-5-14(8-13)18-22-17(11-27-18)19(23)26-2/h3-9,11,21H,10H2,1-2H3 |
| InChIKey | XTGAWJGGRQAISE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 481.39 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[3-[[(3-bromo-5-methylphenyl)sulfonylamino]methyl]phenyl]-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[3-[[(3-bromo-5-methylphenyl)sulfonylamino]methyl]phenyl]-1,3-thiazole-4-carboxylate?
The IUPAC name of methyl 2-[3-[[(3-bromo-5-methylphenyl)sulfonylamino]methyl]phenyl]-1,3-thiazole-4-carboxylate (CID 166333497) is methyl 2-[3-[[(3-bromo-5-methylphenyl)sulfonylamino]methyl]phenyl]-1,3-thiazole-4-carboxylate.
What is the SMILES notation for methyl 2-[3-[[(3-bromo-5-methylphenyl)sulfonylamino]methyl]phenyl]-1,3-thiazole-4-carboxylate?
The canonical SMILES for methyl 2-[3-[[(3-bromo-5-methylphenyl)sulfonylamino]methyl]phenyl]-1,3-thiazole-4-carboxylate is COC(=O)c1csc(-c2cccc(CNS(=O)(=O)c3cc(C)cc(Br)c3)c2)n1.
What is the InChIKey of methyl 2-[3-[[(3-bromo-5-methylphenyl)sulfonylamino]methyl]phenyl]-1,3-thiazole-4-carboxylate?
The InChIKey is XTGAWJGGRQAISE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17BrN2O4S2/c1-12-6-15(20)9-16(7-12)28(24,25)21-10-13-4-3-5-14(8-13)18-22-17(11-27-18)19(23)26-2/h3-9,11,21H,10H2,1-2H3.
What are the key properties of methyl 2-[3-[[(3-bromo-5-methylphenyl)sulfonylamino]methyl]phenyl]-1,3-thiazole-4-carboxylate?
methyl 2-[3-[[(3-bromo-5-methylphenyl)sulfonylamino]methyl]phenyl]-1,3-thiazole-4-carboxylate has a molecular weight of 481.39 g/mol, XLogP of 4.15, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3-[[(3-bromo-5-methylphenyl)sulfonylamino]methyl]phenyl]-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 166333497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).