C20H22N2O2S2 — CID 108782465
N-[[3-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]butane-1-sulfonamide (PubChem CID 108782465) has the molecular formula C20H22N2O2S2 and a molecular weight of 386.54 g/mol. Its IUPAC name is N-[[3-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]butane-1-sulfonamide.
| Compound Name | N-[[3-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 108782465 |
| Molecular Formula | C20H22N2O2S2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | N-[[3-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)NCc1cccc(-c2nc(-c3ccccc3)cs2)c1 |
| InChI | InChI=1S/C20H22N2O2S2/c1-2-3-12-26(23,24)21-14-16-8-7-11-18(13-16)20-22-19(15-25-20)17-9-5-4-6-10-17/h4-11,13,15,21H,2-3,12,14H2,1H3 |
| InChIKey | LEZVMIKJJWXDMG-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |