C16H16N2O2S3 — CID 50846960
N-phenyl-5-(4-propan-2-yl-1,3-thiazol-2-yl)thiophene-2-sulfonamide (PubChem CID 50846960) has the molecular formula C16H16N2O2S3 and a molecular weight of 364.52 g/mol. Its IUPAC name is N-phenyl-5-(4-propan-2-yl-1,3-thiazol-2-yl)thiophene-2-sulfonamide.
| Compound Name | N-phenyl-5-(4-propan-2-yl-1,3-thiazol-2-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 50846960 |
| Molecular Formula | C16H16N2O2S3 |
| Molecular Weight | 364.52 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | N-phenyl-5-(4-propan-2-yl-1,3-thiazol-2-yl)thiophene-2-sulfonamide |
| SMILES | CC(C)c1csc(-c2ccc(S(=O)(=O)Nc3ccccc3)s2)n1 |
| InChI | InChI=1S/C16H16N2O2S3/c1-11(2)13-10-21-16(17-13)14-8-9-15(22-14)23(19,20)18-12-6-4-3-5-7-12/h3-11,18H,1-2H3 |
| InChIKey | CKAIHZQPYUHHQY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |