C19H14ClN3O3S2 — CID 53126844
N-benzyl-4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]thiophene-2-sulfonamide (PubChem CID 53126844) has the molecular formula C19H14ClN3O3S2 and a molecular weight of 431.93 g/mol. Its IUPAC name is N-benzyl-4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]thiophene-2-sulfonamide.
| Compound Name | N-benzyl-4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 53126844 |
| Molecular Formula | C19H14ClN3O3S2 |
| Molecular Weight | 431.93 g/mol |
| Exact Mass | 431.02 |
| IUPAC Name | N-benzyl-4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCc1ccccc1)c1cc(-c2nc(-c3ccc(Cl)cc3)no2)cs1 |
| InChI | InChI=1S/C19H14ClN3O3S2/c20-16-8-6-14(7-9-16)18-22-19(26-23-18)15-10-17(27-12-15)28(24,25)21-11-13-4-2-1-3-5-13/h1-10,12,21H,11H2 |
| InChIKey | BABKVBNVNLNHAJ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.93 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |