C12H13N3O3S2 — CID 53135082
N-(cyclopropylmethyl)-4-(6-oxo-1H-pyridazin-3-yl)thiophene-2-sulfonamide (PubChem CID 53135082) has the molecular formula C12H13N3O3S2 and a molecular weight of 311.39 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-4-(6-oxo-1H-pyridazin-3-yl)thiophene-2-sulfonamide.
| Compound Name | N-(cyclopropylmethyl)-4-(6-oxo-1H-pyridazin-3-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 53135082 |
| Molecular Formula | C12H13N3O3S2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | N-(cyclopropylmethyl)-4-(6-oxo-1H-pyridazin-3-yl)thiophene-2-sulfonamide |
| SMILES | O=c1ccc(-c2csc(S(=O)(=O)NCC3CC3)c2)n[nH]1 |
| InChI | InChI=1S/C12H13N3O3S2/c16-11-4-3-10(14-15-11)9-5-12(19-7-9)20(17,18)13-6-8-1-2-8/h3-5,7-8,13H,1-2,6H2,(H,15,16) |
| InChIKey | BRKLSMMHCLHQOU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |