C14H17N3O3S2 — CID 95092750
3-[5-[(2S)-2-methylpiperidin-1-yl]sulfonylthiophen-3-yl]-1H-pyridazin-6-one (PubChem CID 95092750) has the molecular formula C14H17N3O3S2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 3-[5-[(2S)-2-methylpiperidin-1-yl]sulfonylthiophen-3-yl]-1H-pyridazin-6-one.
| Compound Name | 3-[5-[(2S)-2-methylpiperidin-1-yl]sulfonylthiophen-3-yl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 95092750 |
| Molecular Formula | C14H17N3O3S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 3-[5-[(2S)-2-methylpiperidin-1-yl]sulfonylthiophen-3-yl]-1H-pyridazin-6-one |
| SMILES | C[C@H]1CCCCN1S(=O)(=O)c1cc(-c2ccc(=O)[nH]n2)cs1 |
| InChI | InChI=1S/C14H17N3O3S2/c1-10-4-2-3-7-17(10)22(19,20)14-8-11(9-21-14)12-5-6-13(18)16-15-12/h5-6,8-10H,2-4,7H2,1H3,(H,16,18)/t10-/m0/s1 |
| InChIKey | MTCXBKGHEVSAHU-JTQLQIEISA-N |
| XLogP | 2.06 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |