C16H21N3O3S2 — CID 95092794
2-ethyl-6-[5-[(2S)-2-methylpiperidin-1-yl]sulfonylthiophen-3-yl]pyridazin-3-one (PubChem CID 95092794) has the molecular formula C16H21N3O3S2 and a molecular weight of 367.50 g/mol. Its IUPAC name is 2-ethyl-6-[5-[(2S)-2-methylpiperidin-1-yl]sulfonylthiophen-3-yl]pyridazin-3-one.
| Compound Name | 2-ethyl-6-[5-[(2S)-2-methylpiperidin-1-yl]sulfonylthiophen-3-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 95092794 |
| Molecular Formula | C16H21N3O3S2 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 2-ethyl-6-[5-[(2S)-2-methylpiperidin-1-yl]sulfonylthiophen-3-yl]pyridazin-3-one |
| SMILES | CCn1nc(-c2csc(S(=O)(=O)N3CCCC[C@@H]3C)c2)ccc1=O |
| InChI | InChI=1S/C16H21N3O3S2/c1-3-18-15(20)8-7-14(17-18)13-10-16(23-11-13)24(21,22)19-9-5-4-6-12(19)2/h7-8,10-12H,3-6,9H2,1-2H3/t12-/m0/s1 |
| InChIKey | CGOSAYGCCCITTG-LBPRGKRZSA-N |
| XLogP | 2.55 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |