C16H13N3O3S2 — CID 53134895
3-[5-(2,3-dihydroindol-1-ylsulfonyl)thiophen-3-yl]-1H-pyridazin-6-one (PubChem CID 53134895) has the molecular formula C16H13N3O3S2 and a molecular weight of 359.43 g/mol. Its IUPAC name is 3-[5-(2,3-dihydroindol-1-ylsulfonyl)thiophen-3-yl]-1H-pyridazin-6-one.
| Compound Name | 3-[5-(2,3-dihydroindol-1-ylsulfonyl)thiophen-3-yl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 53134895 |
| Molecular Formula | C16H13N3O3S2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | 3-[5-(2,3-dihydroindol-1-ylsulfonyl)thiophen-3-yl]-1H-pyridazin-6-one |
| SMILES | O=c1ccc(-c2csc(S(=O)(=O)N3CCc4ccccc43)c2)n[nH]1 |
| InChI | InChI=1S/C16H13N3O3S2/c20-15-6-5-13(17-18-15)12-9-16(23-10-12)24(21,22)19-8-7-11-3-1-2-4-14(11)19/h1-6,9-10H,7-8H2,(H,18,20) |
| InChIKey | AJMPBZXQFLXJKH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |