C20H24N4O3S — CID 9030562
N-[2-(4-ethylpiperazin-1-yl)phenyl]-2-oxo-1,3-dihydroindole-5-sulfonamide (PubChem CID 9030562) has the molecular formula C20H24N4O3S and a molecular weight of 400.50 g/mol. Its IUPAC name is N-[2-(4-ethylpiperazin-1-yl)phenyl]-2-oxo-1,3-dihydroindole-5-sulfonamide.
| Compound Name | N-[2-(4-ethylpiperazin-1-yl)phenyl]-2-oxo-1,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 9030562 |
| Molecular Formula | C20H24N4O3S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | N-[2-(4-ethylpiperazin-1-yl)phenyl]-2-oxo-1,3-dihydroindole-5-sulfonamide |
| SMILES | CCN1CCN(c2ccccc2NS(=O)(=O)c2ccc3c(c2)CC(=O)N3)CC1 |
| InChI | InChI=1S/C20H24N4O3S/c1-2-23-9-11-24(12-10-23)19-6-4-3-5-18(19)22-28(26,27)16-7-8-17-15(13-16)14-20(25)21-17/h3-8,13,22H,2,9-12,14H2,1H3,(H,21,25) |
| InChIKey | TYHDTXKVIQHLMH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |