C21H24N4O5S — CID 102156521
ethyl 4-[6-(benzenesulfonamido)-2-oxo-1,3-dihydroindol-5-yl]piperazine-1-carboxylate (PubChem CID 102156521) has the molecular formula C21H24N4O5S and a molecular weight of 444.51 g/mol. Its IUPAC name is ethyl 4-[6-(benzenesulfonamido)-2-oxo-1,3-dihydroindol-5-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[6-(benzenesulfonamido)-2-oxo-1,3-dihydroindol-5-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 102156521 |
| Molecular Formula | C21H24N4O5S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | ethyl 4-[6-(benzenesulfonamido)-2-oxo-1,3-dihydroindol-5-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2cc3c(cc2NS(=O)(=O)c2ccccc2)NC(=O)C3)CC1 |
| InChI | InChI=1S/C21H24N4O5S/c1-2-30-21(27)25-10-8-24(9-11-25)19-12-15-13-20(26)22-17(15)14-18(19)23-31(28,29)16-6-4-3-5-7-16/h3-7,12,14,23H,2,8-11,13H2,1H3,(H,22,26) |
| InChIKey | CRHYGDXMGOKAQD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|