C18H21Cl2N3O2S — CID 17486851
2,6-dichloro-N-[2-(4-ethylpiperazin-1-yl)phenyl]benzenesulfonamide (PubChem CID 17486851) has the molecular formula C18H21Cl2N3O2S and a molecular weight of 414.36 g/mol. Its IUPAC name is 2,6-dichloro-N-[2-(4-ethylpiperazin-1-yl)phenyl]benzenesulfonamide.
| Compound Name | 2,6-dichloro-N-[2-(4-ethylpiperazin-1-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 17486851 |
| Molecular Formula | C18H21Cl2N3O2S |
| Molecular Weight | 414.36 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 2,6-dichloro-N-[2-(4-ethylpiperazin-1-yl)phenyl]benzenesulfonamide |
| SMILES | CCN1CCN(c2ccccc2NS(=O)(=O)c2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C18H21Cl2N3O2S/c1-2-22-10-12-23(13-11-22)17-9-4-3-8-16(17)21-26(24,25)18-14(19)6-5-7-15(18)20/h3-9,21H,2,10-13H2,1H3 |
| InChIKey | XUTIWIOGBFEQIE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |