C20H25N3O2 — CID 122029617
3-[[2-(4-ethylpiperazin-1-yl)anilino]methyl]benzoic acid (PubChem CID 122029617) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 3-[[2-(4-ethylpiperazin-1-yl)anilino]methyl]benzoic acid.
| Compound Name | 3-[[2-(4-ethylpiperazin-1-yl)anilino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122029617 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 3-[[2-(4-ethylpiperazin-1-yl)anilino]methyl]benzoic acid |
| SMILES | CCN1CCN(c2ccccc2NCc2cccc(C(=O)O)c2)CC1 |
| InChI | InChI=1S/C20H25N3O2/c1-2-22-10-12-23(13-11-22)19-9-4-3-8-18(19)21-15-16-6-5-7-17(14-16)20(24)25/h3-9,14,21H,2,10-13,15H2,1H3,(H,24,25) |
| InChIKey | TWRBTOJKKCEUSU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |