C15H15N5O3S — CID 113038293
2-oxo-N-[6-(prop-2-enylamino)pyridazin-3-yl]-1,3-dihydroindole-5-sulfonamide (PubChem CID 113038293) has the molecular formula C15H15N5O3S and a molecular weight of 345.38 g/mol. Its IUPAC name is 2-oxo-N-[6-(prop-2-enylamino)pyridazin-3-yl]-1,3-dihydroindole-5-sulfonamide.
| Compound Name | 2-oxo-N-[6-(prop-2-enylamino)pyridazin-3-yl]-1,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 113038293 |
| Molecular Formula | C15H15N5O3S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 2-oxo-N-[6-(prop-2-enylamino)pyridazin-3-yl]-1,3-dihydroindole-5-sulfonamide |
| SMILES | C=CCNc1ccc(NS(=O)(=O)c2ccc3c(c2)CC(=O)N3)nn1 |
| InChI | InChI=1S/C15H15N5O3S/c1-2-7-16-13-5-6-14(19-18-13)20-24(22,23)11-3-4-12-10(8-11)9-15(21)17-12/h2-6,8H,1,7,9H2,(H,16,18)(H,17,21)(H,19,20) |
| InChIKey | ILIUAVBQJJQCAB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|