C18H21N5O3S — CID 113038296
1-acetyl-N-[6-(prop-2-enylamino)pyridazin-3-yl]-3,4-dihydro-2H-quinoline-6-sulfonamide (PubChem CID 113038296) has the molecular formula C18H21N5O3S and a molecular weight of 387.47 g/mol. Its IUPAC name is 1-acetyl-N-[6-(prop-2-enylamino)pyridazin-3-yl]-3,4-dihydro-2H-quinoline-6-sulfonamide.
| Compound Name | 1-acetyl-N-[6-(prop-2-enylamino)pyridazin-3-yl]-3,4-dihydro-2H-quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 113038296 |
| Molecular Formula | C18H21N5O3S |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 1-acetyl-N-[6-(prop-2-enylamino)pyridazin-3-yl]-3,4-dihydro-2H-quinoline-6-sulfonamide |
| SMILES | C=CCNc1ccc(NS(=O)(=O)c2ccc3c(c2)CCCN3C(C)=O)nn1 |
| InChI | InChI=1S/C18H21N5O3S/c1-3-10-19-17-8-9-18(21-20-17)22-27(25,26)15-6-7-16-14(12-15)5-4-11-23(16)13(2)24/h3,6-9,12H,1,4-5,10-11H2,2H3,(H,19,20)(H,21,22) |
| InChIKey | WRVSTFCQZXMIFW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|