C17H16BrN3O4S — CID 22516477
N-(4-bromo-3-methylphenyl)-3-methyl-2,4-dioxo-1,5-dihydro-1,5-benzodiazepine-7-sulfonamide (PubChem CID 22516477) has the molecular formula C17H16BrN3O4S and a molecular weight of 438.30 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-3-methyl-2,4-dioxo-1,5-dihydro-1,5-benzodiazepine-7-sulfonamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-3-methyl-2,4-dioxo-1,5-dihydro-1,5-benzodiazepine-7-sulfonamide |
|---|---|
| PubChem CID | 22516477 |
| Molecular Formula | C17H16BrN3O4S |
| Molecular Weight | 438.30 g/mol |
| Exact Mass | 437.00 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-3-methyl-2,4-dioxo-1,5-dihydro-1,5-benzodiazepine-7-sulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc3c(c2)NC(=O)C(C)C(=O)N3)ccc1Br |
| InChI | InChI=1S/C17H16BrN3O4S/c1-9-7-11(3-5-13(9)18)21-26(24,25)12-4-6-14-15(8-12)20-17(23)10(2)16(22)19-14/h3-8,10,21H,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | BIWDWDCCUJXZQD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.30 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|