C16H12N2O5S — CID 46361446
N-(1,3-benzodioxol-5-yl)-2-oxo-1H-quinoline-6-sulfonamide (PubChem CID 46361446) has the molecular formula C16H12N2O5S and a molecular weight of 344.35 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-oxo-1H-quinoline-6-sulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-oxo-1H-quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 46361446 |
| Molecular Formula | C16H12N2O5S |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-oxo-1H-quinoline-6-sulfonamide |
| SMILES | O=c1ccc2cc(S(=O)(=O)Nc3ccc4c(c3)OCO4)ccc2[nH]1 |
| InChI | InChI=1S/C16H12N2O5S/c19-16-6-1-10-7-12(3-4-13(10)17-16)24(20,21)18-11-2-5-14-15(8-11)23-9-22-14/h1-8,18H,9H2,(H,17,19) |
| InChIKey | CMIXVFCREBPTQF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |