C19H31N5O3S — CID 53108244
N-cycloheptyl-5-(ethylsulfonylamino)-2-piperazin-1-ylpyridine-3-carboxamide (PubChem CID 53108244) has the molecular formula C19H31N5O3S and a molecular weight of 409.56 g/mol. Its IUPAC name is N-cycloheptyl-5-(ethylsulfonylamino)-2-piperazin-1-ylpyridine-3-carboxamide.
| Compound Name | N-cycloheptyl-5-(ethylsulfonylamino)-2-piperazin-1-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 53108244 |
| Molecular Formula | C19H31N5O3S |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | N-cycloheptyl-5-(ethylsulfonylamino)-2-piperazin-1-ylpyridine-3-carboxamide |
| SMILES | CCS(=O)(=O)Nc1cnc(N2CCNCC2)c(C(=O)NC2CCCCCC2)c1 |
| InChI | InChI=1S/C19H31N5O3S/c1-2-28(26,27)23-16-13-17(18(21-14-16)24-11-9-20-10-12-24)19(25)22-15-7-5-3-4-6-8-15/h13-15,20,23H,2-12H2,1H3,(H,22,25) |
| InChIKey | JRJHJSZJKWGXDP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |