C32H33FN4O4S — CID 46110417
2-fluoro-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(1-phenylethylsulfamoyl)phenyl]benzamide (PubChem CID 46110417) has the molecular formula C32H33FN4O4S and a molecular weight of 588.71 g/mol. Its IUPAC name is 2-fluoro-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(1-phenylethylsulfamoyl)phenyl]benzamide.
| Compound Name | 2-fluoro-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(1-phenylethylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 46110417 |
| Molecular Formula | C32H33FN4O4S |
| Molecular Weight | 588.71 g/mol |
| Exact Mass | 588.22 |
| IUPAC Name | 2-fluoro-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(1-phenylethylsulfamoyl)phenyl]benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)c3ccccc3F)cc2S(=O)(=O)NC(C)c2ccccc2)CC1 |
| InChI | InChI=1S/C32H33FN4O4S/c1-23(24-10-4-3-5-11-24)35-42(39,40)31-22-25(34-32(38)26-12-6-7-13-27(26)33)16-17-29(31)37-20-18-36(19-21-37)28-14-8-9-15-30(28)41-2/h3-17,22-23,35H,18-21H2,1-2H3,(H,34,38) |
| InChIKey | GXZHBNKGRFSEOK-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.71 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|