C26H32N4O5S2 — CID 46110604
5-(methanesulfonamido)-2-[4-(4-methoxyphenyl)piperazin-1-yl]-N-(1-phenylethyl)benzenesulfonamide (PubChem CID 46110604) has the molecular formula C26H32N4O5S2 and a molecular weight of 544.70 g/mol. Its IUPAC name is 5-(methanesulfonamido)-2-[4-(4-methoxyphenyl)piperazin-1-yl]-N-(1-phenylethyl)benzenesulfonamide.
| Compound Name | 5-(methanesulfonamido)-2-[4-(4-methoxyphenyl)piperazin-1-yl]-N-(1-phenylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 46110604 |
| Molecular Formula | C26H32N4O5S2 |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | 5-(methanesulfonamido)-2-[4-(4-methoxyphenyl)piperazin-1-yl]-N-(1-phenylethyl)benzenesulfonamide |
| SMILES | COc1ccc(N2CCN(c3ccc(NS(C)(=O)=O)cc3S(=O)(=O)NC(C)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C26H32N4O5S2/c1-20(21-7-5-4-6-8-21)27-37(33,34)26-19-22(28-36(3,31)32)9-14-25(26)30-17-15-29(16-18-30)23-10-12-24(35-2)13-11-23/h4-14,19-20,27-28H,15-18H2,1-3H3 |
| InChIKey | LRGPKWLDGKOJEI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|