C30H34N4O4S2 — CID 98422925
N-[4-(4-ethylpiperazin-1-yl)-3-[[(1R)-1-phenylethyl]sulfamoyl]phenyl]naphthalene-2-sulfonamide (PubChem CID 98422925) has the molecular formula C30H34N4O4S2 and a molecular weight of 578.76 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)-3-[[(1R)-1-phenylethyl]sulfamoyl]phenyl]naphthalene-2-sulfonamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)-3-[[(1R)-1-phenylethyl]sulfamoyl]phenyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 98422925 |
| Molecular Formula | C30H34N4O4S2 |
| Molecular Weight | 578.76 g/mol |
| Exact Mass | 578.20 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)-3-[[(1R)-1-phenylethyl]sulfamoyl]phenyl]naphthalene-2-sulfonamide |
| SMILES | CCN1CCN(c2ccc(NS(=O)(=O)c3ccc4ccccc4c3)cc2S(=O)(=O)N[C@H](C)c2ccccc2)CC1 |
| InChI | InChI=1S/C30H34N4O4S2/c1-3-33-17-19-34(20-18-33)29-16-14-27(22-30(29)40(37,38)31-23(2)24-9-5-4-6-10-24)32-39(35,36)28-15-13-25-11-7-8-12-26(25)21-28/h4-16,21-23,31-32H,3,17-20H2,1-2H3/t23-/m1/s1 |
| InChIKey | OLBFWVBETNUSOK-HSZRJFAPSA-N |
| XLogP | 4.82 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.76 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|